CymitQuimica logo

CAS 69312-43-2

:

5-Pyrimidinecarboxylic acid, 2,4-dichloro-, 1-methylethyl ester

Description:
5-Pyrimidinecarboxylic acid, 2,4-dichloro-, 1-methylethyl ester, known by its CAS number 69312-43-2, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a carboxylic acid functional group that is esterified with an isopropyl group, contributing to its ester characteristics. The presence of two chlorine atoms at the 2 and 4 positions of the pyrimidine ring introduces significant electronegativity, which can influence the compound's reactivity and solubility. Typically, such compounds exhibit moderate to high polarity due to the carboxylic acid and ester functionalities, affecting their solubility in polar solvents. Additionally, the chlorinated pyrimidine derivatives are often of interest in pharmaceutical and agrochemical applications due to their potential biological activity. The compound's stability, reactivity, and interaction with biological systems can be influenced by the specific arrangement of its functional groups and substituents.
Formula:C8H8Cl2N2O2
InChI:InChI=1S/C8H8Cl2N2O2/c1-4(2)14-7(13)5-3-11-8(10)12-6(5)9/h3-4H,1-2H3
InChI key:YRJUHXRUVTWBKE-UHFFFAOYSA-N
SMILES:CC(C)OC(=O)C1=CN=C(N=C1Cl)Cl
Synonyms:
  • Isopropanyl 2,4-Dichloropyrimidine-5-Carboxylate
Found 4 products.