CymitQuimica logo

CAS 693245-53-3

:

2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 3-oxo-, 1,1-dimethylethylester, (1R,4S)-

Description:
2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 3-oxo-, 1,1-dimethylethyl ester, (1R,4S)- is a bicyclic compound characterized by its unique azabicyclo structure, which incorporates a nitrogen atom into a seven-membered ring system. This compound features a carboxylic acid derivative with an ester functional group, specifically an isopropyl ester, contributing to its lipophilicity and potential bioactivity. The stereochemistry indicated by (1R,4S) suggests specific spatial arrangements of substituents around the chiral centers, which can significantly influence the compound's pharmacological properties. The presence of the 3-oxo group indicates a ketone functionality, which may enhance reactivity and interaction with biological targets. This compound is likely to exhibit interesting chemical behavior due to its bicyclic framework and functional groups, making it a candidate for various applications in medicinal chemistry and drug development. Its CAS number, 693245-53-3, allows for precise identification in chemical databases and literature.
Formula:C11H17NO3
InChI:InChI=1S/C11H17NO3/c1-11(2,3)15-10(14)12-8-5-4-7(6-8)9(12)13/h7-8H,4-6H2,1-3H3/t7-,8+/m0/s1
InChI key:JGKYCLQDFDRUQJ-JGVFFNPUSA-N
SMILES:CC(C)(C)OC(=O)N1[C@@H]2CC[C@@H](C2)C1=O
Found 2 products.