CAS 6937-03-7
:Methyl 2-aminopyridine-4-carboxylate
Description:
Methyl 2-aminopyridine-4-carboxylate, with the CAS number 6937-03-7, is an organic compound characterized by its pyridine ring structure, which features both an amino group and a carboxylate ester functional group. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its role in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the reactivity of the amino and carboxylate groups. The presence of the methyl ester enhances its solubility in organic solvents, making it useful in various chemical reactions. Methyl 2-aminopyridine-4-carboxylate can participate in nucleophilic substitutions and coupling reactions, contributing to the formation of more complex molecular architectures. Additionally, it may exhibit biological activity, which is of interest in medicinal chemistry. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact. Proper safety protocols should be followed when working with this substance in laboratory settings.
Formula:C7H8N2O2
InChI:InChI=1/C7H8N2O2/c1-11-7(10)5-2-3-9-6(8)4-5/h2-4H,1H3,(H2,8,9)
SMILES:COC(=O)c1cc[nH]c(=N)c1
Synonyms:- 2-Aminopyridinecarboxylic acid methyl ester
- Methyl 2-aminoisonicotinate
- 2-Aminopyridine-4-carboxylic acid methyl ester
- methyl 2-aminoisonicotinate, (2-Amino-4-pyridinecarboxylic acid methylester)
- Methyl 2-Amino-4-pyridinecarboxylate
- 2-Amino-isonicotinic acid methyl ester
- 2-Aminoisonicotinic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 2-Aminoisonicotinate
CAS:Formula:C7H8N2O2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:152.15Methyl 2-aminoisonicotinate
CAS:Methyl 2-aminoisonicotinateFormula:C7H8N2O2Purity:97%Color and Shape:Yellow-brown Solid-PowderMolecular weight:152.15062Methyl 2-aminoisonicotinate
CAS:Formula:C7H8N2O2Purity:95%Color and Shape:SolidMolecular weight:152.1506Methyl 2-aminopyridine-4-carboxylate
CAS:Formula:C7H8N2O2Purity:97%Color and Shape:SolidMolecular weight:152.153



