CymitQuimica logo

CAS 693764-34-0

:

3-[(3-methylphenoxy)methyl]piperidine

Description:
3-[(3-Methylphenoxy)methyl]piperidine, identified by its CAS number 693764-34-0, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The structure features a 3-methylphenoxy group attached to a methylene bridge, linking it to the piperidine ring. This compound is typically classified as an organic amine and may exhibit properties such as moderate solubility in organic solvents, depending on the specific functional groups present. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and aliphatic components that can influence biological activity. The compound may also display specific interactions with biological targets, making it of interest in drug design and synthesis. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C13H19NO
InChI:InChI=1/C13H19NO/c1-11-4-2-6-13(8-11)15-10-12-5-3-7-14-9-12/h2,4,6,8,12,14H,3,5,7,9-10H2,1H3
InChI key:HBAOHEHNXIVPDG-UHFFFAOYSA-N
SMILES:CC1=CC(=CC=C1)OCC2CCCNC2
Found 3 products.