CymitQuimica logo

CAS 693792-98-2

:

Carbamic acid, (4-bromophenyl)(phenylmethyl)-, 1,1-dimethylethyl ester

Description:
Carbamic acid, (4-bromophenyl)(phenylmethyl)-, 1,1-dimethylethyl ester, identified by the CAS number 693792-98-2, is an organic compound characterized by its carbamate functional group. This compound features a complex structure that includes a 4-bromophenyl group and a phenylmethyl moiety, contributing to its unique chemical properties. The presence of the 1,1-dimethylethyl ester group enhances its stability and solubility in organic solvents. Typically, carbamates exhibit moderate to high lipophilicity, which can influence their biological activity and potential applications in pharmaceuticals or agrochemicals. The bromine substituent may impart specific reactivity or biological interactions, making this compound of interest in medicinal chemistry. Additionally, the ester functionality suggests potential for hydrolysis under acidic or basic conditions, leading to the release of the corresponding alcohol and carbamic acid. Overall, the characteristics of this compound make it a subject of interest for further research in various chemical and biological contexts.
Formula:C18H20BrNO2
InChI:InChI=1S/C18H20BrNO2/c1-18(2,3)22-17(21)20(13-14-7-5-4-6-8-14)16-11-9-15(19)10-12-16/h4-12H,13H2,1-3H3
InChI key:MKEUJYLWUDYPAQ-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N(CC1=CC=CC=C1)C2=CC=C(C=C2)Br
Found 2 products.