CymitQuimica logo

CAS 694433-59-5

:

SB505124

Description:
SB505124, with the CAS number 694433-59-5, is a small molecule that functions primarily as a selective inhibitor of the protein kinase activity of certain members of the p38 mitogen-activated protein kinase (MAPK) family. This compound is characterized by its ability to modulate cellular signaling pathways, which are crucial in various biological processes, including inflammation and stress responses. SB505124 has been studied for its potential therapeutic applications, particularly in conditions where p38 MAPK is implicated, such as autoimmune diseases and cancer. The compound is typically characterized by its moderate solubility in organic solvents and relatively low solubility in water, which can influence its bioavailability and pharmacokinetic properties. Additionally, its molecular structure includes specific functional groups that contribute to its binding affinity and selectivity towards target kinases. Overall, SB505124 represents a valuable tool in biochemical research and drug development aimed at targeting MAPK pathways.
Formula:C20H21N3O2
InChI:InChI=1S/C20H21N3O2/c1-12-6-5-7-14(21-12)18-17(22-19(23-18)20(2,3)4)13-8-9-15-16(10-13)25-11-24-15/h5-10H,11H2,1-4H3,(H,22,23)
InChI key:WGZOTBUYUFBEPZ-UHFFFAOYSA-N
SMILES:CC1=NC(=CC=C1)C2=C(N=C(N2)C(C)(C)C)C3=CC4=C(C=C3)OCO4
Found 9 products.