CAS 6948-30-7
:3-Bromo-4,5-dimethoxybenzaldehyde
Description:
3-Bromo-4,5-dimethoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a bromine atom and two methoxy groups attached to a benzaldehyde moiety. The presence of the bromine substituent typically enhances the compound's reactivity, making it useful in various synthetic applications, particularly in the field of organic chemistry. The methoxy groups contribute to the compound's electron-donating properties, influencing its reactivity and solubility in organic solvents. This compound is often utilized as an intermediate in the synthesis of more complex organic molecules, including pharmaceuticals and agrochemicals. Its aldehyde functional group is reactive, allowing for further transformations such as condensation reactions. Additionally, 3-Bromo-4,5-dimethoxybenzaldehyde may exhibit specific physical properties such as a distinct melting or boiling point, and it may be characterized by techniques such as NMR and IR spectroscopy to confirm its structure and purity. Safety precautions should be observed when handling this compound, as with many brominated and aldehyde-containing substances, due to potential toxicity and reactivity.
Formula:C9H9BrO3
InChI:InChI=1S/C9H9BrO3/c1-12-8-4-6(5-11)3-7(10)9(8)13-2/h3-5H,1-2H3
InChI key:InChIKey=ICVODPFGWCUVJC-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C(Br)=CC(C=O)=C1
Synonyms:- 3,4-Dimethoxy-5-bromobenzaldehyde
- 3-Bromo-4,5-dimethoxybenzaldehyde
- 5-Bromo-3,4-dimethoxybenzaldehyde
- Benzaldehyde, 3-bromo-4,5-dimethoxy-
- NSC 55757
- Veratraldehyde, 5-bromo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Bromo-4,5-dimethoxybenzaldehyde
CAS:Formula:C9H9BrO3Purity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:245.073,4-Dimethoxy-5-bromobenzaldehyde
CAS:3,4-Dimethoxy-5-bromobenzaldehydeFormula:C9H9BrO3Purity:99%Molecular weight:245.069953-Bromo-4,5-dimethoxybenzaldehyde
CAS:Formula:C9H9BrO3Purity:95%Color and Shape:SolidMolecular weight:245.07003-Bromo-4,5-dimethoxybenzaldehyde
CAS:3-Bromo-4,5-dimethoxybenzaldehyde is a molecule that is acidic in nature. It inhibits phosphatases and has shown cytotoxic activity against cancer cells in vitro. This compound also has antibacterial properties and can be used to treat bacterial infections. 3-Bromo-4,5-dimethoxybenzaldehyde is also a synthetic compound that can be found in the bisbenzylisoquinoline alkaloids family. It has been shown to have anti-tumor activity as well as an interaction with aldehydes and chalcones, which may lead to anti-inflammatory effects.
Formula:C9H9BrO3Purity:Min. 95%Color and Shape:PowderMolecular weight:245.07 g/mol3-Bromo-4,5-dimethoxybenzaldehyde
CAS:Formula:C9H9BrO3Purity:98%Color and Shape:SolidMolecular weight:245.072




