CymitQuimica logo

CAS 69519-35-3

:

deoxycholic acid ethyl ester

Description:
Deoxycholic acid ethyl ester, with the CAS number 69519-35-3, is a derivative of deoxycholic acid, a bile acid that plays a crucial role in the emulsification and absorption of dietary fats. This compound is characterized by its ester functional group, which enhances its solubility and bioavailability compared to its parent acid. Deoxycholic acid ethyl ester is typically a white to off-white solid or a viscous liquid, depending on its formulation and purity. It is known for its amphiphilic properties, allowing it to interact with both hydrophilic and hydrophobic environments, making it useful in various biochemical applications, including drug delivery systems and as a surfactant. Additionally, it may exhibit biological activities related to lipid metabolism and cell signaling. Safety and handling precautions should be observed, as with any chemical substance, due to potential irritant properties. Overall, deoxycholic acid ethyl ester is a significant compound in both pharmaceutical and biochemical research contexts.
Formula:C26H44O4
InChI:InChI=1/C26H44O4/c1-5-30-24(29)11-6-16(2)20-9-10-21-19-8-7-17-14-18(27)12-13-25(17,3)22(19)15-23(28)26(20,21)4/h16-23,27-28H,5-15H2,1-4H3/t16-,17-,18-,19+,20-,21+,22+,23+,25+,26-/m1/s1
InChI key:ZFVNCIMEWULGEX-VAYUFCLWSA-N
SMILES:CCOC(=O)CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)O)C
Synonyms:
  • Ethyl 3-Alpha,12-Alpha-Dihydroxy-5-Beta-Cholan-24-Oate
  • Ethyl (3Alpha,5Beta,12Alpha)-3,12-Dihydroxycholan-24-Oate
Found 6 products.