CymitQuimica logo

CAS 6966-01-4

:

Methyl 3-amino-6-bromopyrazine-2-carboxylate

Description:
Methyl 3-amino-6-bromopyrazine-2-carboxylate is a chemical compound characterized by its pyrazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a methyl ester functional group, an amino group, and a bromine substituent, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the amino group suggests that it can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a versatile intermediate in the synthesis of more complex molecules. The bromine atom introduces a halogen, which can enhance the compound's electrophilicity and facilitate further functionalization. Methyl 3-amino-6-bromopyrazine-2-carboxylate is typically used in research settings, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features that may impart specific biological activities. As with many chemical substances, proper handling and safety precautions are essential, given its potential reactivity and the presence of halogenated components.
Formula:C6H6BrN3O2
InChI:InChI=1/C6H6BrN3O2/c1-12-6(11)4-5(8)9-2-3(7)10-4/h2H,1H3,(H2,8,9)
InChI key:CNXSIRHOIFRMOB-UHFFFAOYSA-N
SMILES:COC(=O)c1c(N)ncc(Br)n1
Synonyms:
  • 5-Amino-2-Bromo-6-Pyrazinecarboxylic Acidmethyl Ester
  • 3-Amino-6-bromopyrazine-2-carboxylic acid methyl ester
  • Methyl 6-Bromo-3-aminopyrazine-2-carboxylic ester
  • Methyl 3-amino-6-bromopyrazine-2-carboxylic ester
  • See more synonyms
Found 7 products.