CAS 6969-16-0
:Tridecenoicacid; 80%
Description:
Tridecenoic acid, with the CAS number 6969-16-0, is a long-chain unsaturated fatty acid characterized by its 13 carbon atoms and a double bond typically located at the 9th position from the carboxylic end. This fatty acid is part of the family of fatty acids known as alkenoic acids, which are recognized for their unsaturation. Tridecenoic acid is often found in various natural sources, including certain plant oils and animal fats. Its physical properties include a relatively high melting point compared to saturated fatty acids of similar chain length, and it is typically a liquid at room temperature. The presence of the double bond contributes to its reactivity, making it useful in various chemical applications, including the production of surfactants, emulsifiers, and other industrial chemicals. Additionally, it can be involved in biochemical processes and may have implications in nutrition and health. As with many fatty acids, it is important to handle it with care, considering its potential effects on human health and the environment.
Formula:C13H24O2
InChI:InChI=1/C13H24O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h11-12H,2-10H2,1H3,(H,14,15)/b12-11-
InChI key:GQVYBECSNBLQJV-VAWYXSNFSA-N
SMILES:CCCCCCCCCC/C=C\C(=O)O
Synonyms:- 2-Tridecenoic acid
- Tridec-2-Enoic Acid
- (2Z)-tridec-2-enoic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Tridecenoic Acid
CAS:Formula:C13H24O2Purity:>80.0%(GC)Color and Shape:White to Light yellow to Light orange powder to lump to clear liquidMolecular weight:212.332-Tridecenoic acid
CAS:2-Tridecenoic acid is an organic compound classified as a fatty acid. It has a slightly rancid odor and is commonly found in various foods, including dairy products and meats. In the chemical and pharmaceutical industries, 2-Tridecenoic acid serves multiple purposes, particularly as an intermediate in the synthesis of various chemicals and pharmaceuticals. Furthermore, it holds potential for inhibiting bacterial infections and diseases related to inflammation.Formula:C13H24O2Molecular weight:212.3285
