CymitQuimica logo

CAS 697-37-0

:

1-(1-Propynyl)cyclohexanol

Description:
1-(1-Propynyl)cyclohexanol, with the CAS number 697-37-0, is an organic compound characterized by a cyclohexanol ring substituted with a propynyl group. This compound features a hydroxyl (-OH) functional group, which contributes to its classification as an alcohol. The presence of the propynyl group introduces a triple bond, imparting unique reactivity and properties to the molecule. Typically, compounds like this exhibit moderate polarity due to the hydroxyl group, which can engage in hydrogen bonding, influencing their solubility in polar solvents. The structure allows for potential applications in organic synthesis and as intermediates in the production of more complex molecules. Additionally, the compound's physical properties, such as boiling point and melting point, are influenced by the size of the cyclohexane ring and the nature of the substituents. Safety and handling considerations are essential, as with many organic compounds, due to potential flammability and toxicity. Overall, 1-(1-Propynyl)cyclohexanol is a notable compound in organic chemistry with specific characteristics that make it of interest for various chemical applications.
Formula:C9H14O
InChI:InChI=1/C9H14O/c1-2-6-9(10)7-4-3-5-8-9/h10H,3-5,7-8H2,1H3
InChI key:UTISCLIDFORRJP-UHFFFAOYSA-N
SMILES:CC#CC1(CCCCC1)O
Synonyms:
  • 1-(Prop-1-yn-1-yl)cyclohexanol
  • Cyclohexanol, 1-(1-Propyn-1-Yl)-
Found 2 products.