CAS 6974-05-6
:decyl chloroacetate
Description:
Decyl chloroacetate is an organic compound characterized by its ester functional group, specifically derived from decanol and chloroacetic acid. It typically appears as a colorless to pale yellow liquid with a distinctive sweet, fruity odor. The compound is known for its moderate volatility and relatively low solubility in water, making it more soluble in organic solvents such as ethanol and ether. Its molecular structure includes a decyl chain, which contributes to its hydrophobic properties, while the chloroacetate moiety introduces reactivity due to the presence of the chlorine atom. Decyl chloroacetate is often utilized in the synthesis of various chemical intermediates and can serve as a fragrance or flavoring agent in the cosmetic and food industries. Additionally, it may exhibit biological activity, which warrants careful handling and consideration of safety protocols during its use in laboratory or industrial settings. As with many chlorinated compounds, it is important to assess its environmental impact and potential health effects.
Formula:C12H23ClO2
InChI:InChI=1/C12H23ClO2/c1-2-3-4-5-6-7-8-9-10-15-12(14)11-13/h2-11H2,1H3
InChI key:WLAYVQKPZABXSY-UHFFFAOYSA-N
SMILES:CCCCCCCCCCOC(=O)CCl
Synonyms:- Acetic acid, chloro-, n-decyl ester
- Acetic acid, chloro-, decyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

