CymitQuimica logo

CAS 697793-63-8

:

2-chloro-6,7-dimethoxy-4-methyl-quinoline

Description:
2-Chloro-6,7-dimethoxy-4-methyl-quinoline is a chemical compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features a chlorine atom at the 2-position and two methoxy groups at the 6 and 7 positions, along with a methyl group at the 4-position of the quinoline ring. These substituents influence its chemical properties, including its solubility, reactivity, and potential biological activity. The presence of the methoxy groups can enhance lipophilicity, potentially affecting its interaction with biological membranes. The chlorine atom may also contribute to the compound's reactivity, making it a candidate for various chemical reactions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. However, specific applications and biological activities would require further investigation through experimental studies. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C12H12ClNO2
InChI:InChI=1/C12H12ClNO2/c1-7-4-12(13)14-9-6-11(16-3)10(15-2)5-8(7)9/h4-6H,1-3H3
SMILES:Cc1cc(Cl)nc2cc(c(cc12)OC)OC
Found 1 products.