CAS 6979-94-8
:Tri-O-acetylguanosine
Description:
Tri-O-acetylguanosine is a modified nucleoside derivative of guanosine, characterized by the presence of three acetyl groups attached to the hydroxyl groups of the ribose sugar. This modification enhances the lipophilicity and stability of the molecule, making it useful in various biochemical applications. The compound retains the purine base guanine, which is essential for its role in nucleic acid metabolism. Tri-O-acetylguanosine is often utilized in synthetic chemistry and molecular biology, particularly in the synthesis of oligonucleotides and as a building block for RNA synthesis. Its acetylation can influence the solubility and reactivity of the nucleoside, allowing for easier manipulation in laboratory settings. Additionally, the compound may exhibit unique biological properties, including potential antiviral or therapeutic effects, although further research is necessary to fully elucidate these aspects. Overall, Tri-O-acetylguanosine serves as a valuable tool in the study of nucleic acids and their functions in biological systems.
Formula:C16H19N5O8
InChI:InChI=1S/C16H19N5O8/c1-6(22)26-4-9-11(27-7(2)23)12(28-8(3)24)15(29-9)21-5-18-10-13(21)19-16(17)20-14(10)25/h5,9,11-12,15H,4H2,1-3H3,(H3,17,19,20,25)/t9-,11-,12-,15-/m1/s1
InChI key:InChIKey=ULXDFYDZZFYGIY-SDBHATRESA-N
SMILES:O(C(C)=O)[C@H]1[C@@H](O[C@H](COC(C)=O)[C@H]1OC(C)=O)N2C3=C(N=C2)C(=O)N=C(N)N3
Synonyms:- 2',3',5'-O-Triacetyl-guanosine
- 2',3',5'-Triacetylguanosine
- 2-amino-9-(2,3,5-tri-O-acetyl-beta-D-lyxofuranosyl)-3,9-dihydro-6H-purin-6-one
- 2-amino-9-(2,3,5-tri-O-acetylpentofuranosyl)-3,9-dihydro-6H-purin-6-one
- 2′,3′,5′-Tri-O-acetylguanosine
- Guanosine triacetate
- Guanosine, 2′,3′,5′-triacetate
- NSC 66387
- Tri-O-acetylguanosine
- Triacetylguanosine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
2',3',5'-Tri-O-acetylguanosine
CAS:Formula:C16H19N5O8Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:409.362',3',5'-Tri-acetylguanosine
CAS:2',3',5'-Tri-acetylguanosineFormula:C16H19N5O8Purity:98%Color and Shape:White SolidMolecular weight:409.3552',3',5'-Tri-O-acetylguanosine
CAS:Formula:C16H19N5O8Purity:95%Color and Shape:SolidMolecular weight:409.35082'',3'',5''-Tri-O-acetylguanosine
CAS:Formula:C10H12IN5O4Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:393.142',3',5'-Tri-O-acetylguanosine
CAS:2',3',5'-Tri-O-acetylguanosine is a protected form of the nucleoside guanosine which has potential application as a synthetic intermediate in nucleic acid and nucleoside chemistry.Formula:C16H19N5O8Purity:Min. 95%Color and Shape:White PowderMolecular weight:409.35 g/mol2’,3’,5’-Tri-O-acetyl Guanosine-13C2,15N
CAS:Controlled ProductApplications 2’,3’,5’-Tri-O-acetyl Guanosine-13C2,15N is an intermediate in the synthesis of 8-Aminoguanosine-13C2,15N (A609877). 8-Aminoguanosine-13C2,15N is an isotopic labelled compound of 8-Aminoguanosine (A609875), which is a potent inhibitor of purine nucleoside phosphorylase.
References Kazmers, I.S., et al.: Science, 214, 1137 (1981); Chern, J-W., et al.: J. Med. Chem., 36, 1024 (1993)Formula:C2C14H1915NN4O8Color and Shape:NeatMolecular weight:412.3292’,3’,5’-Tri-O-acetyl Guanosine
CAS:Controlled ProductApplications 2’,3’,5’-Tri-O-acetyl Guanosine (cas# 6979-94-8) is a compound useful in organic synthesis.
Formula:C16H19N5O8Color and Shape:NeatMolecular weight:409.35








