CymitQuimica logo

CAS 698-80-6

:

3,4-difluorobenzyl chloride

Description:
3,4-Difluorobenzyl chloride is an organic compound characterized by the presence of a benzyl group substituted with two fluorine atoms at the 3 and 4 positions, along with a chlorine atom. Its molecular formula is C7H5ClF2, indicating that it contains seven carbon atoms, five hydrogen atoms, one chlorine atom, and two fluorine atoms. This compound typically appears as a colorless to pale yellow liquid with a distinctive aromatic odor. It is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the electrophilic benzyl chloride moiety. The fluorine substituents can influence the compound's physical properties, such as boiling point and solubility, making it less polar than its non-fluorinated counterparts. 3,4-Difluorobenzyl chloride is utilized in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals, where the introduction of fluorine can enhance biological activity or modify chemical properties. Safety precautions should be observed when handling this compound, as it may be harmful if inhaled or absorbed through the skin.
Formula:C7H5ClF2
InChI:InChI=1/C7H5ClF2/c8-4-5-1-2-6(9)7(10)3-5/h1-3H,4H2
InChI key:VTGRVYJPIVZZGS-UHFFFAOYSA-N
SMILES:c1cc(c(cc1CCl)F)F
Synonyms:
  • 4-(Chloromethyl)-1,2-Difluorobenzene
Found 5 products.