CymitQuimica logo

CAS 69861-89-8

:

na-cbz-L-lysine thiobenzyl ester*hydrochloride

Description:
Na-Cbz-L-lysine thiobenzyl ester hydrochloride is a chemical compound that serves as a derivative of lysine, an essential amino acid. This compound features a carbobenzyloxy (Cbz) protecting group, which is commonly used in peptide synthesis to protect the amino group of lysine. The thiobenzyl ester moiety indicates the presence of a thiobenzyl group, which can influence the compound's reactivity and solubility. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. The compound is often utilized in biochemical research and peptide synthesis due to its ability to facilitate the formation of peptide bonds while protecting the amino group. Its characteristics include being a white to off-white crystalline powder, with a specific melting point range and solubility profile that can vary depending on the solvent. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C21H27ClN2O3S
InChI:InChI=1/C21H26N2O3S.ClH/c22-14-8-7-13-19(20(24)27-16-18-11-5-2-6-12-18)23-21(25)26-15-17-9-3-1-4-10-17;/h1-6,9-12,19H,7-8,13-16,22H2,(H,23,25);1H/t19-;/m0./s1
InChI key:PNDSXGXPDJRQAV-FYZYNONXSA-N
SMILES:c1ccc(cc1)COC(=N[C@@H](CCCCN)C(=O)SCc1ccccc1)O.Cl
Synonyms:
  • Z-Lys-SBzl . HCl
  • N(a)-Benzyloxycarbonyl-L-lysine Thiobenzyl Ester, HCl
  • S-benzyl (2S)-6-amino-2-{[(benzyloxy)carbonyl]amino}hexanethioate hydrochloride (1:1)
Found 6 products.