CAS 69955-43-7
:N~5~-(diaminomethylidene)-2-(difluoromethyl)ornithine
Description:
N~5~-(diaminomethylidene)-2-(difluoromethyl)ornithine, with the CAS number 69955-43-7, is a synthetic organic compound that belongs to the class of amino acids and derivatives. This substance features a unique structure characterized by the presence of a difluoromethyl group and a diaminomethylidene moiety, which contribute to its biological activity. It is primarily recognized for its potential role as an inhibitor of arginine metabolism, making it of interest in pharmacological research, particularly in the context of cancer and other diseases where arginine plays a critical role. The compound is typically a white to off-white solid and is soluble in polar solvents. Its reactivity is influenced by the functional groups present, allowing for various chemical interactions. As with many synthetic compounds, safety data should be consulted, as it may pose hazards if not handled properly. Overall, N~5~-(diaminomethylidene)-2-(difluoromethyl)ornithine represents a significant area of study in medicinal chemistry and biochemistry.
Formula:C7H14F2N4O2
InChI:InChI=1/C7H14F2N4O2/c8-4(9)7(12,5(14)15)2-1-3-13-6(10)11/h4H,1-3,12H2,(H,14,15)(H4,10,11,13)
SMILES:C(CC(C(F)F)(C(=O)O)N)CNC(=N)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Amino-2-(difluoromethyl)-5-guanidinopentanoic acid
CAS:Formula:C7H14F2N4O2Purity:95%Color and Shape:SolidMolecular weight:224.2085α-(difluoromethyl)-DL-Arginine
CAS:α-(difluoromethyl)-DL-ArgininePurity:≥98%Molecular weight:224.21g/molDL-alpha-(Difluoromethyl)arginine
CAS:Controlled ProductStability Hygroscopic
Applications Used for plant growth regulation.
References Asaka, I., et al.: Biotechnol. Lett., 15, 1259 (1993), Bajaj, S., et al.: Plant Cell Rep., 14, 717 (1995), Bastola, D., et al.: Plant Physiol., 109, 63 (1995), Bernet, E., et al.: Plant Physiol. Biochem., 36, 759 (1998),Formula:C7H14F2N4O2Color and Shape:Off-WhiteMolecular weight:224.21α-(difluoromethyl)-DL-Arginine
CAS:α-(difluoromethyl)-DL-Arginine (RMI 71897) is an enzyma-activated, irreversible inhibitor of arginine decarboxylase for E.Formula:C7H14F2N4O2Purity:99.77% - 99.78%Color and Shape:SolidMolecular weight:224.21



