CymitQuimica logo

CAS 69976-39-2

:

2-(4-Bromophenyl)benzofuran

Description:
2-(4-Bromophenyl)benzofuran is an organic compound characterized by its unique structure, which consists of a benzofuran moiety substituted with a bromophenyl group. This compound features a fused benzene and furan ring, contributing to its aromatic properties and potential reactivity. The presence of the bromine atom enhances its electrophilic character, making it a candidate for various chemical reactions, including nucleophilic substitutions. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The compound's molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, its brominated nature may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 2-(4-Bromophenyl)benzofuran is a compound of interest due to its structural features and potential applications in various chemical fields.
Formula:C14H9BrO
InChI:InChI=1S/C14H9BrO/c15-12-7-5-10(6-8-12)14-9-11-3-1-2-4-13(11)16-14/h1-9H
InChI key:InChIKey=OKLLCXQQBVCIPA-UHFFFAOYSA-N
SMILES:BrC1=CC=C(C2=CC=3C(O2)=CC=CC3)C=C1
Synonyms:
  • 2-(4-Bromophenyl)benzofuran
  • 2-(4-Bromophenyl)-1-benzofuran
  • Benzofuran, 2-(4-bromophenyl)-
Found 2 products.