CAS 70-57-5
:5-Methylnicotinamide
Description:
5-Methylnicotinamide is a derivative of nicotinamide, which is a form of vitamin B3. It is characterized by the presence of a methyl group at the 5-position of the pyridine ring. This compound is typically a white to off-white crystalline solid and is soluble in water and various organic solvents, reflecting its polar nature due to the presence of the amide functional group. 5-Methylnicotinamide is known for its role in biological systems, particularly in cellular metabolism and as a precursor in the synthesis of NAD+ (nicotinamide adenine dinucleotide), a crucial coenzyme in redox reactions. Additionally, it has been studied for its potential therapeutic effects, including anti-inflammatory properties and its role in modulating cellular signaling pathways. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in experimental settings. Overall, 5-Methylnicotinamide is a significant compound in both biochemical research and potential pharmaceutical applications.
Formula:C7H8N2O
InChI:InChI=1/C7H8N2O/c1-5-2-6(7(8)10)4-9-3-5/h2-4H,1H3,(H2,8,10)
SMILES:Cc1cc(cnc1)C(=N)O
Synonyms:- 5-Methylpyridine-3-carboxamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Methylnicotinamide, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H8N2OPurity:97%Color and Shape:White to cream, Crystals or powder or crystalline powderMolecular weight:136.155-Methylnicotinamide
CAS:Controlled ProductApplications 5-methylnicotinamide (cas# 70-57-5) is a useful research chemical.
Formula:C7H8N2OColor and Shape:NeatMolecular weight:136.15





