CAS 700-44-7
:2-Hydroxy-6-methoxybenzaldehyde
Description:
2-Hydroxy-6-methoxybenzaldehyde, also known as vanillin acetate, is an organic compound characterized by its aromatic structure, which includes a hydroxyl group (-OH) and a methoxy group (-OCH3) attached to a benzaldehyde moiety. This compound typically appears as a pale yellow to light brown solid or liquid, depending on its purity and form. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the hydroxyl and methoxy groups contributes to its reactivity, allowing it to participate in various chemical reactions, including electrophilic aromatic substitution and condensation reactions. 2-Hydroxy-6-methoxybenzaldehyde is often used in the synthesis of fragrances, flavoring agents, and as an intermediate in organic synthesis. Additionally, it exhibits potential biological activities, including antioxidant properties, making it of interest in pharmaceutical and cosmetic applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C8H8O3
InChI:InChI=1S/C8H8O3/c1-11-8-4-2-3-7(10)6(8)5-9/h2-5,10H,1H3
InChI key:InChIKey=DZJPDDVDKXHRLF-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=O)C(O)=CC=C1
Synonyms:- 2-Hydroxy-6-Methoxy Benzaldehyde
- 2-Hydroxy-6-methoxybenzaldehyde
- 6-Hydroxy-2-methoxybenzaldehyde
- 6-Hydroxy-o-anisaldehyde
- Benzaldehyde, 2-hydroxy-6-methoxy-
- Ramal
- o-Anisaldehyde, 6-hydroxy-
- 6-Methoxysalicylaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Hydroxy-6-methoxybenzaldehyde, 98+%
CAS:2-Hydroxy-6-methoxybenzaldehyde is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU rFormula:C8H8O3Purity:98+%Color and Shape:Pale yellow to brown, Crystals or powder or crystalline powderMolecular weight:152.152-Hydroxy-6-methoxybenzaldehyde
CAS:Formula:C8H8O3Purity:98%Color and Shape:SolidMolecular weight:152.14732-Hydroxy-6-methoxybenzaldehyde
CAS:2-Hydroxy-6-methoxybenzaldehydeFormula:C8H8O3Purity:98%Color and Shape:SolidMolecular weight:152.147322-Hydroxy-6-methoxybenzaldehyde
CAS:Formula:C8H8O3Purity:>98.0%(GC)(T)Color and Shape:White to Light orange to Pale yellow green powder to crystalMolecular weight:152.152-Hydroxy-6-methoxybenzaldehyde
CAS:2-Hydroxy-6-methoxybenzaldehyde is a molecule that can form hydrogen bonds with other molecules. FT-IR spectroscopy has shown that this compound has a copper complex and an acidic proton, which may be due to intramolecular hydrogen bonding interactions. The compound also has been shown to have potent inhibitory activity against cellular growth and cancer cells in vitro. 2-Hydroxy-6-methoxybenzaldehyde is a metal chelator and can therefore bind to metals such as iron and copper. It is genotoxic, which means it damages DNA by causing DNA strand breaks or crosslinks, leading to cell death. This chemical may also cause genetic mutations through the formation of tautomers that make DNA replication difficult. Gel chromatography shows that 2HMB has a low molecular weight (MW) and high solubility.Formula:C8H8O3Purity:Min. 95%Color and Shape:PowderMolecular weight:152.15 g/mol2-Hydroxy-6-methoxybenzaldehyde
CAS:Formula:C8H8O3Purity:98%Color and Shape:Pale yellow to brown powderMolecular weight:152.149







