CAS 70000-57-6
:N-(4-methylbenzyl)cyclopentanamine
Description:
N-(4-methylbenzyl)cyclopentanamine, with the CAS number 70000-57-6, is an organic compound characterized by its cyclopentane structure substituted with an amine group and a 4-methylbenzyl moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the cyclopentane ring contributes to its three-dimensional structure, potentially affecting its reactivity and interactions with other molecules. The 4-methylbenzyl group adds hydrophobic characteristics, which may enhance its lipophilicity. In terms of applications, compounds of this nature may be explored in pharmaceuticals or as intermediates in organic synthesis due to their unique structural features. However, specific safety and handling information should be consulted, as with any chemical substance, to ensure proper usage and compliance with regulations.
Formula:C13H19N
InChI:InChI=1/C13H19N/c1-11-6-8-12(9-7-11)10-14-13-4-2-3-5-13/h6-9,13-14H,2-5,10H2,1H3
SMILES:Cc1ccc(cc1)CNC1CCCC1
Synonyms:- benzenemethanamine, N-cyclopentyl-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
