CymitQuimica logo

CAS 70010-48-9

:

4-(2-Thienyl)aniline

Description:
4-(2-Thienyl)aniline, with the CAS number 70010-48-9, is an organic compound characterized by the presence of both an aniline group and a thienyl group. Structurally, it features a thiophene ring (a five-membered aromatic ring containing sulfur) attached to the para position of an aniline moiety (an amino group attached to a benzene ring). This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the amino group, which can participate in various chemical reactions, including electrophilic substitutions and coupling reactions. The thienyl group can influence the electronic properties of the molecule, potentially enhancing its reactivity and stability. 4-(2-Thienyl)aniline may find applications in organic synthesis, materials science, and as a building block in the development of dyes, pharmaceuticals, or other functional materials. Its unique structure allows for interesting interactions in both chemical and biological contexts, making it a subject of interest in various fields of research.
Formula:C10H9NS
InChI:InChI=1/C10H9NS/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h1-7H,11H2
InChI key:WPNWHSQJRALLBJ-UHFFFAOYSA-N
SMILES:c1cc(c2ccc(cc2)N)sc1
Synonyms:
  • 4-Thien-2-Ylaniline
  • 4-Thiophen-2-yl-phenylamine
  • 4-(Thiophen-2-Yl)Aniline
Found 4 products.