CymitQuimica logo

CAS 70122-89-3

:

Allyl Formic acid-tert-butyl ester

Description:
Allyl formic acid-tert-butyl ester, with the CAS number 70122-89-3, is an organic compound characterized by its ester functional group, which is formed from the reaction of allyl alcohol and formic acid with tert-butyl alcohol. This compound typically appears as a colorless to pale yellow liquid and is known for its distinctive fruity odor. It is soluble in organic solvents, making it useful in various chemical applications. The presence of the allyl group contributes to its reactivity, allowing it to participate in various chemical reactions, including polymerization and cross-linking processes. Additionally, the tert-butyl group enhances its stability and steric hindrance, which can influence its reactivity and interactions with other substances. Allyl formic acid-tert-butyl ester may be utilized in the synthesis of other organic compounds, as well as in the formulation of fragrances and flavoring agents. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C8H14O3
InChI:InChI=1S/C8H14O3/c1-5-6-10-7(9)11-8(2,3)4/h5H,1,6H2,2-4H3
InChI key:SWQDRYKDDGFPLL-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)OCC=C
Synonyms:
  • Allyl Tert-Butyl Carbonate
Found 4 products.