CymitQuimica logo

CAS 701221-57-0

:

3-(5-oxo-3-propyl-4,5-dihydro-1H-pyrazol-1-yl)benzoic acid

Description:
3-(5-oxo-3-propyl-4,5-dihydro-1H-pyrazol-1-yl)benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety and a pyrazole ring. The presence of the pyrazole ring contributes to its potential biological activity, as pyrazoles are often associated with various pharmacological properties. The compound features a propyl group attached to the pyrazole, which may influence its solubility and reactivity. As a benzoic acid derivative, it possesses acidic properties, allowing it to participate in acid-base reactions. The compound's molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its CAS number, 701221-57-0, provides a unique identifier for regulatory and research purposes. Overall, this compound's characteristics, including its functional groups and structural features, may contribute to its utility in various chemical and biological applications.
Formula:C13H14N2O3
InChI:InChI=1/C13H14N2O3/c1-2-4-10-8-12(16)15(14-10)11-6-3-5-9(7-11)13(17)18/h3,5-7H,2,4,8H2,1H3,(H,17,18)
SMILES:CCCC1=NN(c2cccc(c2)C(=O)O)C(=O)C1
Synonyms:
  • benzoic acid, 3-(4,5-dihydro-5-oxo-3-propyl-1H-pyrazol-1-yl)-
Found 2 products.