CymitQuimica logo

CAS 7014-39-3

:

Neoisoliquiritin

Description:
Neoisoliquiritin, with the CAS number 7014-39-3, is a flavonoid compound primarily derived from licorice root (Glycyrrhiza glabra). It is known for its potential health benefits, including antioxidant, anti-inflammatory, and anti-cancer properties. Structurally, neoisoliquiritin is characterized by its flavanone backbone, which contributes to its biological activity. The compound exhibits solubility in organic solvents and has limited solubility in water, typical of many flavonoids. Neoisoliquiritin has garnered interest in pharmacological research due to its ability to modulate various biochemical pathways, making it a subject of study for potential therapeutic applications. Additionally, it may play a role in enhancing the bioavailability of other compounds when used in formulations. Its safety profile is generally considered favorable, but further studies are necessary to fully understand its effects and mechanisms of action in biological systems. Overall, neoisoliquiritin represents a promising area of research in natural product chemistry and its applications in health and medicine.
Formula:C21H22O9
InChI:InChI=1S/C21H22O9/c22-10-17-18(26)19(27)20(28)21(30-17)29-13-5-1-11(2-6-13)3-8-15(24)14-7-4-12(23)9-16(14)25/h1-9,17-23,25-28H,10H2/b8-3+/t17-,18-,19+,20-,21-/m1/s1
InChI key:YNWXJFQOCHMPCK-LXGDFETPSA-N
SMILES:C1=CC(=CC=C1/C=C/C(=O)C2=C(C=C(C=C2)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O
Synonyms:
  • 1-(2,4-Dihydroxyphenyl)-3-[4-(beta-D-glucopyranosyloxy)phenyl]-2-propen-1-one
Found 4 products.