CymitQuimica logo

CAS 702-77-2

:

1-bromo-3-methyltricyclo[3.3.1.1~3,7~]decane

Description:
1-Bromo-3-methyltricyclo[3.3.1.1^3,7]decane is a bicyclic organic compound characterized by its unique tricyclic structure, which consists of three interconnected cycloalkane rings. The presence of a bromine atom at the first position and a methyl group at the third position contributes to its reactivity and physical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is relatively insoluble in water but soluble in organic solvents, which is common for many halogenated hydrocarbons. The bromine substituent can participate in various chemical reactions, such as nucleophilic substitution, making it useful in organic synthesis. Additionally, the compound's structure may impart specific stereochemical properties, influencing its interactions in biological systems or materials science. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous and may pose environmental concerns. Overall, 1-bromo-3-methyltricyclo[3.3.1.1^3,7]decane is of interest in both academic research and industrial applications.
Formula:C11H17Br
InChI:InChI=1/C11H17Br/c1-10-3-8-2-9(4-10)6-11(12,5-8)7-10/h8-9H,2-7H2,1H3
InChI key:MXAYGTASSPYUJB-UHFFFAOYSA-N
SMILES:CC12CC3CC(C1)CC(C3)(C2)Br
Synonyms:
  • 1-Bromo-3-methyladamantane
  • 1-Bromo-3-Methyadamantane
Found 7 products.