CAS 70217-36-6

(1Z)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol

Description:

The chemical substance known as (1Z)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol, with the CAS number 70217-36-6, is a synthetic organic compound that belongs to the class of triazole derivatives. It features a complex structure characterized by a pentene backbone, which includes a hydroxyl group and a triazole moiety, contributing to its potential biological activity. The presence of the 2,4-dichlorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound is often studied for its fungicidal properties, making it relevant in agricultural chemistry, particularly in the development of fungicides. Its unique structural features may also confer specific modes of action against fungal pathogens. As with many synthetic chemicals, safety and environmental impact assessments are crucial for its application in various fields. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function in the realm of agrochemicals.

Formula:C₁₅H₁₇Cl₂N₃O

InChI:InChI=1/C15H17Cl2N3O/c1-15(2,3)14(21)13(20-9-18-8-19-20)6-10-4-5-11(16)7-12(10)17/h4-9,14,21H,1-3H3/b13-6-

SMILES:CC(C)(C)C(/C(=C/c1ccc(cc1Cl)Cl)/n1cncn1)O

Synonyms:

1H-1,2,4-Triazole-1-ethanol, beta-((2,4-dichlorophenyl)methylene)-alpha-(1,1-dimethylethyl)-, (betaZ)-
(1Z)-1-(2,4-Dichlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pent-1-en-3-ol