CymitQuimica logo

CAS 703-18-4

:

Phenyl trifluoromethyl sulphoxide

Description:
Phenyl trifluoromethyl sulfoxide, with the CAS number 703-18-4, is an organosulfur compound characterized by the presence of a trifluoromethyl group (-CF3) attached to a phenyl ring and a sulfoxide functional group (R-S(=O)-R'). This compound typically appears as a colorless to pale yellow liquid and is known for its polar nature, which enhances its solubility in various organic solvents. The trifluoromethyl group imparts unique electronic properties, making it a valuable reagent in organic synthesis and medicinal chemistry. Phenyl trifluoromethyl sulfoxide exhibits moderate stability under standard conditions but can undergo reactions typical of sulfoxides, such as oxidation or reduction. Its reactivity and ability to act as a solvent or reagent in various chemical reactions make it significant in synthetic organic chemistry. Additionally, due to the presence of fluorine atoms, it may exhibit distinct biological activities, although specific biological properties would require further investigation. Safety precautions should be observed when handling this compound, as with many organofluorine substances.
Formula:C7H5F3OS
InChI:InChI=1S/C7H5F3OS/c8-7(9,10)12(11)6-4-2-1-3-5-6/h1-5H
InChI key:WZAJOJWOOXXUCT-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)S(=O)C(F)(F)F
Found 6 products.