CymitQuimica logo

CAS 70411-27-7

:

4H-1-Benzopyran-4-one,2,3-dihydro-3,5,7-trihydroxy-2-(3-hydroxy-4-methoxyphenyl)-, (2R,3R)-

Description:
The chemical substance known as "4H-1-Benzopyran-4-one, 2,3-dihydro-3,5,7-trihydroxy-2-(3-hydroxy-4-methoxyphenyl)-, (2R,3R)-" with CAS number 70411-27-7 is a flavonoid derivative characterized by its complex polyphenolic structure. This compound features a benzopyran core, which is typical of flavonoids, and is substituted with multiple hydroxyl groups that contribute to its potential antioxidant properties. The presence of a methoxy group enhances its solubility and may influence its biological activity. The stereochemistry indicated by the (2R,3R) configuration suggests specific spatial arrangements of the substituents, which can affect the compound's reactivity and interaction with biological targets. Such compounds are often studied for their pharmacological properties, including anti-inflammatory, antimicrobial, and anticancer activities. Additionally, the presence of multiple hydroxyl groups typically enhances the compound's ability to scavenge free radicals, making it of interest in the field of natural product chemistry and medicinal research.
Formula:C16H14O7
InChI:InChI=1S/C16H14O7/c1-22-11-3-2-7(4-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,15-19,21H,1H3/t15-,16+/m0/s1
InChI key:KQNGHARGJDXHKF-JKSUJKDBSA-N
SMILES:COC1=C(C=C(C=C1)[C@@H]2[C@H](C(=O)C3=C(C=C(C=C3O2)O)O)O)O
Found 6 products.