CymitQuimica logo

CAS 705-09-9

:

2-Difluoromethyl-1H-benzoimidazole

Description:
2-Difluoromethyl-1H-benzoimidazole is a chemical compound characterized by its unique structure, which includes a benzoimidazole core substituted with a difluoromethyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the benzoimidazole moiety, which is known for its role in various pharmacological applications. The difluoromethyl group enhances the lipophilicity and metabolic stability of the molecule, potentially influencing its reactivity and interaction with biological targets. In terms of physical properties, it may be a solid or liquid at room temperature, depending on its specific formulation and purity. The compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Safety data sheets would indicate handling precautions due to the presence of fluorine, which can impart toxicity. Overall, 2-Difluoromethyl-1H-benzoimidazole represents a class of compounds of interest in both synthetic and medicinal chemistry.
Formula:C8H6F2N2
InChI:InChI=1/C8H6F2N2/c9-7(10)8-11-5-3-1-2-4-6(5)12-8/h1-4,7H,(H,11,12)
InChI key:PURNIHSRWGYONZ-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)nc(C(F)F)[nH]2
Synonyms:
  • 1H-benzimidazole, 2-(difluoromethyl)-
  • 2-(Difluormethyl)-1H-benzimidazol
  • 2-(Difluoromethyl)-1H-benzimidazole
Found 5 products.