CymitQuimica logo

CAS 706820-95-3

:

3-(tert-butylamino)sulfonyl-phenylboronic acid pinacol ester

Description:
3-(tert-Butylamino)sulfonyl-phenylboronic acid pinacol ester is a chemical compound characterized by its boronic acid functionality, which is typically involved in Suzuki coupling reactions, a key method in organic synthesis for forming carbon-carbon bonds. The presence of the tert-butylamino group suggests that the compound may exhibit basic properties, potentially influencing its solubility and reactivity. The sulfonyl group enhances the compound's polarity and may also affect its interaction with biological systems. The pinacol ester moiety indicates that the compound is a derivative of boronic acid, which can stabilize the boron atom and improve its handling and storage properties. This compound is likely to be used in various synthetic applications, particularly in the development of pharmaceuticals or complex organic molecules. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular structure and the presence of functional groups, making it important for researchers to consider these factors when utilizing this compound in their work.
Formula:C16H26BNO4S
InChI:InChI=1S/C16H26BNO4S/c1-14(2,3)18-23(19,20)13-10-8-9-12(11-13)17-21-15(4,5)16(6,7)22-17/h8-11,18H,1-7H3
InChI key:VSJNPEGKWGUNOP-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)S(=O)(=O)NC(C)(C)C
Synonyms:
  • T-Butylamino-Sulfonyl-Phenylboronic Acid Pinacol Ester
Found 4 products.