CymitQuimica logo

CAS 707-16-4

:

1,3-diazaspiro[4.6]undecane-2,4-dione

Description:
1,3-Diazaspiro[4.6]undecane-2,4-dione, with the CAS number 707-16-4, is a bicyclic compound featuring a spiro structure that incorporates two nitrogen atoms within its framework. This compound is characterized by its unique spirocyclic arrangement, which contributes to its distinct chemical properties. The presence of two carbonyl groups (diones) in the structure enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and cycloadditions. The nitrogen atoms in the diaza moiety can participate in hydrogen bonding, influencing the compound's solubility and interaction with other molecules. Typically, such compounds exhibit moderate stability under standard conditions but may undergo transformations under specific circumstances, such as changes in pH or temperature. The compound's potential applications span across medicinal chemistry and materials science, where its unique structure may be leveraged for the development of novel pharmaceuticals or functional materials. Overall, 1,3-diazaspiro[4.6]undecane-2,4-dione represents an intriguing subject for further research due to its structural complexity and potential utility in various chemical contexts.
Formula:C9H14N2O2
InChI:InChI=1/C9H14N2O2/c12-7-9(11-8(13)10-7)5-3-1-2-4-6-9/h1-6H2,(H2,10,11,12,13)
InChI key:DEXMKKYRTKSOCW-UHFFFAOYSA-N
SMILES:C1CCCC2(CC1)C(=NC(=N2)O)O
Found 5 products.