CymitQuimica logo

CAS 70882-66-5

:

Z-D-Dab-OH

Description:
Z-D-Dab-OH, with the CAS number 70882-66-5, is a chemical compound that belongs to the class of amino acids and is often used in peptide synthesis and research. It features a protected form of the amino acid D-2,4-diaminobutyric acid (D-Dab), which is characterized by the presence of two amino groups and a hydroxyl group. This compound is typically utilized in the development of peptides due to its ability to introduce specific functionalities and enhance the stability of peptide chains. Z-D-Dab-OH is known for its role in facilitating the formation of peptide bonds and can be employed in various applications, including drug development and biochemistry research. Its structural characteristics allow for the incorporation of unique properties into peptides, making it a valuable tool in synthetic chemistry. As with many chemical substances, handling Z-D-Dab-OH requires adherence to safety protocols to mitigate any potential hazards associated with its use.
Formula:C12H16N2O4
InChI:InChI=1S/C12H16N2O4/c13-7-6-10(11(15)16)14-12(17)18-8-9-4-2-1-3-5-9/h1-5,10H,6-8,13H2,(H,14,17)(H,15,16)/t10-/m1/s1
InChI key:KXMSCBRTBLPGIN-SNVBAGLBSA-N
SMILES:C1=CC=C(C=C1)COC(=O)N[C@H](CCN)C(=O)O
Synonyms:
  • N-Alpha-Cbz-D-2-4-Diaminobutanoic Acid
Found 4 products.