CymitQuimica logo

CAS 70917-02-1

:

[1,1′-Biphenyl]-4-carboxylic acid, 4′-formyl-, ethyl ester

Description:
[1,1′-Biphenyl]-4-carboxylic acid, 4′-formyl-, ethyl ester, commonly referred to as a biphenyl derivative, is an organic compound characterized by its biphenyl structure with functional groups that include a carboxylic acid and an aldehyde moiety, esterified with an ethyl group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents such as ethanol and acetone, while being less soluble in water due to its hydrophobic biphenyl backbone. The presence of the carboxylic acid and aldehyde groups contributes to its reactivity, making it a potential candidate for various chemical reactions, including esterification and condensation reactions. Its unique structure allows for applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit interesting physical properties, such as melting and boiling points, which are influenced by its molecular interactions and the presence of functional groups. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C16H14O3
InChI:InChI=1S/C16H14O3/c1-2-19-16(18)15-9-7-14(8-10-15)13-5-3-12(11-17)4-6-13/h3-11H,2H2,1H3
InChI key:InChIKey=GGDSRNHFXHUEHE-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=CC=C(C=C1)C2=CC=C(C=O)C=C2
Synonyms:
  • Ethyl 4′-formyl-1,1′-biphenyl-4-carboxylate
  • Ethyl 4′-formyl-4-biphenylcarboxylate
  • [1,1′-Biphenyl]-4-carboxylic acid, 4′-formyl-, ethyl ester
  • 4′-Ethoxycarbonyl-1,1′-biphenyl-4-carboxaldehyde
Found 4 products.