CymitQuimica logo

CAS 709667-96-9

:

Ethanone, 1-[3'-(trifluoromethyl)[1,1'-biphenyl]-4-yl]-

Description:
Ethanone, 1-[3'-(trifluoromethyl)[1,1'-biphenyl]-4-yl]- is an organic compound characterized by its biphenyl structure substituted with a trifluoromethyl group and an ethanone functional group. This compound features a biphenyl moiety, which consists of two phenyl rings connected by a single bond, enhancing its stability and contributing to its aromatic properties. The trifluoromethyl group (-CF3) is known for its electron-withdrawing effects, which can influence the reactivity and polarity of the molecule. The ethanone functional group indicates the presence of a carbonyl (C=O) adjacent to an ethyl group, which can participate in various chemical reactions, including nucleophilic additions. This compound may exhibit unique physical properties such as a specific boiling point and solubility characteristics, influenced by the presence of the trifluoromethyl group. Additionally, its potential applications could span across pharmaceuticals, agrochemicals, or materials science, depending on its reactivity and interaction with biological systems or other chemical entities.
Formula:C15H11F3O
InChI:InChI=1S/C15H11F3O/c1-10(19)11-5-7-12(8-6-11)13-3-2-4-14(9-13)15(16,17)18/h2-9H,1H3
InChI key:OLPGMSBHVQSWJI-UHFFFAOYSA-N
SMILES:CC(=O)C1=CC=C(C=C1)C2=CC(=CC=C2)C(F)(F)F
Found 4 products.