CymitQuimica logo

CAS 7101-96-4

:

3-Bromoquinolin-6-amine

Description:
3-Bromoquinolin-6-amine is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 3-position and an amino group at the 6-position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. It may exhibit properties such as antimicrobial, antitumor, or anti-inflammatory effects, making it of interest in drug discovery. The compound is soluble in various organic solvents, and its reactivity can be influenced by the functional groups present. Additionally, 3-Bromoquinolin-6-amine can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C9H7BrN2
InChI:InChI=1/C9H7BrN2/c10-7-3-6-4-8(11)1-2-9(6)12-5-7/h1-5H,11H2
InChI key:XOXNGIYWQRRRPW-UHFFFAOYSA-N
SMILES:c1cc2c(cc(cn2)Br)cc1N
Synonyms:
  • 6-Amino-3-bromoquinoline
Found 5 products.