CAS 711-02-4
:bicyclo[2.2.2]octane-1,4-dicarboxylic acid
Description:
Bicyclo[2.2.2]octane-1,4-dicarboxylic acid, with the CAS number 711-02-4, is a bicyclic organic compound characterized by its unique structure, which consists of a bicyclo[2.2.2]octane framework with two carboxylic acid functional groups located at the 1 and 4 positions. This compound is typically a white crystalline solid at room temperature and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid groups, which can engage in hydrogen bonding. The dicarboxylic acid nature of this compound allows it to participate in various chemical reactions, including esterification and amidation, making it useful in organic synthesis and materials science. Its bicyclic structure contributes to its rigidity and potential applications in the development of polymers and other advanced materials. Additionally, the compound may exhibit interesting properties related to its molecular conformation and steric effects, which can influence its reactivity and interactions with other chemical species.
Formula:C10H14O4
InChI:InChI=1/C10H14O4/c11-7(12)9-1-2-10(5-3-9,6-4-9)8(13)14/h1-6H2,(H,11,12)(H,13,14)
SMILES:C1CC2(CCC1(CC2)C(=O)O)C(=O)O
Synonyms:- Bicyclo[2.2.2]Octane-1,4-Dicarboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Bicyclo[2.2.2]octane-1,4-dicarboxylic Acid
CAS:Formula:C10H14O4Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:198.22Bicyclo[2.2.2]octane-1,4-dicarboxylic acid
CAS:Bicyclo[2.2.2]octane-1,4-dicarboxylic acidFormula:C10H14O4Purity:98%Color and Shape:SolidMolecular weight:198.21576Bicyclo[2.2.2]octane-1,4-dicarboxylicacid
CAS:Formula:C10H14O4Purity:95%Color and Shape:SolidMolecular weight:198.2158Ref: IN-DA005E8U
1kgTo inquire250gTo inquire500gTo inquire250mg23.00€1g25.00€100mg27.00€5g62.00€10g116.00€25g199.00€50g267.00€100g668.00€Bicyclo[2.2.2]octane-1,4-dicarboxylic acid
CAS:Bicyclo[2.2.2]octane-1,4-dicarboxylic acid is a type of PROTAClinker used in the synthesis of PROTAC molecules.Formula:C10H14O4Molecular weight:198.22bicyclo[2.2.2]octane-1,4-dicarboxylic acid
CAS:Bicyclo[2.2.2]octane-1,4-dicarboxylic acidFormula:C10H14O4Purity:96%Molecular weight:198.22Bicyclo[2.2.2] octane-1,4 dicarboxylic acid
CAS:Formula:C10H14O4Purity:97%Color and Shape:SolidMolecular weight:198.218





