CymitQuimica logo

CAS 7126-41-2

:

phenyl(1H-pyrrol-3-yl)methanone

Description:
Phenyl(1H-pyrrol-3-yl)methanone, also known by its CAS number 7126-41-2, is an organic compound characterized by the presence of a phenyl group and a pyrrole ring. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The pyrrole moiety is a five-membered aromatic ring containing nitrogen, which imparts unique electronic properties and can participate in various chemical reactions, including electrophilic substitutions. The phenyl group enhances the compound's stability and solubility in organic solvents. Due to its structural features, phenyl(1H-pyrrol-3-yl)methanone may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, this compound serves as a valuable building block in the synthesis of more complex organic molecules and may have applications in pharmaceuticals and agrochemicals.
Formula:C11H9NO
InChI:InChI=1/C11H9NO/c13-11(10-6-7-12-8-10)9-4-2-1-3-5-9/h1-8,12H
InChI key:DSNSKSWTLGZGAN-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C(=O)c1cc[nH]c1
Synonyms:
  • methanone, phenyl-1H-pyrrol-3-yl-
  • Phenyl(1H-pyrrol-3-yl)methanon
  • Phenyl(1H-pyrrol-3-yl)methanone
Found 5 products.