CAS 71386-38-4
:jatropholone B
Description:
Jatropholone B is a natural compound derived from the Jatropha plant, specifically known for its presence in Jatropha curcas. It belongs to the class of compounds known as terpenoids, which are characterized by their diverse structures and biological activities. Jatropholone B exhibits various pharmacological properties, including potential anti-inflammatory and anti-cancer effects, making it a subject of interest in medicinal chemistry. The compound's structure features a bicyclic framework, which contributes to its unique chemical behavior and interactions. Additionally, it is known for its role in the plant's defense mechanisms against pests and pathogens. As with many natural products, the extraction and purification of jatropholone B can be complex, often requiring advanced chromatographic techniques. Its potential applications in pharmaceuticals and agriculture highlight the importance of studying such compounds for their therapeutic benefits and ecological roles. Further research is ongoing to fully elucidate its mechanisms of action and potential uses in various fields.
Formula:C20H24O2
InChI:InChI=1S/C20H24O2/c1-9-6-7-13-17(20(13,4)5)15-11(3)19(22)12-8-10(2)18(21)16(12)14(9)15/h10,13,17,22H,1,6-8H2,2-5H3/t10-,13-,17-/m1/s1
InChI key:BMHPRIPRPDSKRK-OMXAPOSASA-N
SMILES:C[C@@H]1CC2=C(C(=C3[C@H]4[C@H](C4(C)C)CCC(=C)C3=C2C1=O)C)O
Synonyms:- Jatropholone-B
- (1aR)-1,1aβ,4,5,7,8,9,9aβ-Octahydro-3-hydroxy-1,1,2,5β-tetramethyl-7-methylene-6H-cyclopropa[3,4]cyclohept[1,2-e]inden-6-one
- 6H-Cyclopropa[3,4]cyclohept[1,2-e]inden-6-one, 1,1a,4,5,7,8,9,9a-octahydro-3-hydroxy-1,1,2,5-tetramethyl-7-methylene-, (1aR,5R,9aS)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(1aR)-1,1aβ,4,5,7,8,9,9aβ-Octahydro-3-hydroxy-1,1,2,5β-tetramethyl-7-methylene-6H-cyclopropa[3,4]cyclohept[1,2-e]inden-6-one
CAS:(1aR)-1,1aβ,4,5,7,8,9,9aβ-Octahydro-3-hydroxy-1,1,2,5β-tetramethyl-7-methylene-6H-cyclopropa[3,4]cyclohept[1,2-e]inden-6-oneFormula:C20H24O2Purity:≥98%Molecular weight:296.4Jatropholone B
CAS:Jatropholone B shows antiproliferative activity against cancer cell lines. It also has gastroprotective activity in preventing the gastric lesions in mice.Formula:C20H24O2Purity:98%Color and Shape:SolidMolecular weight:296.4Jatropholone B
CAS:Jatropholone B is a diterpenoid compound, which is a type of organic substance characterized by its multi-ring chemical structure. It is sourced from plants belonging to the genus Jatropha, commonly found in tropical and subtropical regions. The mode of action of Jatropholone B involves disrupting cellular processes, particularly by inhibiting cellular proliferation and inducing apoptosis in cancer cells. This is achieved through the modulation of various signaling pathways, leading to its potential use as an anticancer agent.Formula:C20H24O2Purity:Min. 95%Molecular weight:296.4 g/mol





