CAS 71484-85-0
:(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(4-nitrophenoxy)tetrahydropyran-2-carboxylic acid
Description:
The chemical substance known as (2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(4-nitrophenoxy)tetrahydropyran-2-carboxylic acid, with the CAS number 71484-85-0, is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple hydroxyl (-OH) groups, specifically at the 3, 4, and 5 positions, contributing to its hydrophilicity and potential for forming hydrogen bonds. The presence of a carboxylic acid group at the 2 position enhances its acidity and reactivity. Additionally, the 6-position is substituted with a 4-nitrophenoxy group, which introduces an aromatic system that can influence the compound's electronic properties and reactivity. The stereochemistry, indicated by the R and S designations, suggests specific spatial arrangements of the substituents, which can significantly affect the compound's biological activity and interactions. Overall, this compound may have applications in pharmaceuticals or as a biochemical probe due to its functional groups and structural features.
Formula:C12H13NO9
InChI:InChI=1/C12H13NO9/c14-7-8(15)10(11(17)18)22-12(9(7)16)21-6-3-1-5(2-4-6)13(19)20/h1-4,7-10,12,14-16H,(H,17,18)/t7-,8-,9-,10+,12-/m0/s1
Synonyms:- 4-Nitrophenyl β-L-gulopyranosiduronic acid
- β-L-gulopyranosiduronic acid, 4-nitrophenyl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2S,3S,4S,5R,6R)-3,4,5-Trihydroxy-6-(4-nitrophenoxy)tetrahydro-2H-pyran-2-carboxylic acid
CAS:(2S,3S,4S,5R,6R)-3,4,5-Trihydroxy-6-(4-nitrophenoxy)tetrahydro-2H-pyran-2-carboxylic acidFormula:C12H13NO9Purity:97%Molecular weight:315.23(2S,3S,4S,5R,6R)-3,4,5-Trihydroxy-6-(4-nitrophenoxy)tetrahydro-2H-pyran-2-carboxylic acid
CAS:Formula:C12H13NO9Purity:97%Color and Shape:SolidMolecular weight:315.23294-Nitrophenyl α-D-glucuronide
CAS:4-Nitrophenyl alpha-D-glucuronide is a chromogenic substrate widely used for detecting and quantifying the activity of alpha glucuronidase enzyme. Upon cleavage by the enzyme, it releases the yellow-colored 4-nitrophenol, whose absorbance can be monitored spectrophotometrically. This substrate is routinely employed in biochemistry and molecular biology applications, such as enzyme assays, enzyme kinetics studies, and characterization of recombinant enzymes. As a non-toxic and easy-to-use reagent, 4-Nitrophenyl alpha-D-glucuronide provides a convenient and sensitive method for studying alpha-glucuronidase activity in various biological samples, including cell extracts, tissue homogenates, and purified enzyme preparations.
Formula:C12H13NO9Purity:Min. 97 Area-%Color and Shape:Off-White PowderMolecular weight:315.23 g/mol




