CAS 71764-07-3
:O-(N-Acetyl-α-neuraminosyl)-(2→6)-O-[O-(N-acetyl-α-neuraminosyl)-(2→3)-β-D-galactopyranosyl-(1→3)]-2-(acetylamino)-2-deoxy-D-galactose
Description:
The chemical substance known as O-(N-Acetyl-α-neuraminosyl)-(2→6)-O-[O-(N-acetyl-α-neuraminosyl)-(2→3)-β-D-galactopyranosyl-(1→3)]-2-(acetylamino)-2-deoxy-D-galactose, with the CAS number 71764-07-3, is a complex glycosylated compound. It features multiple sugar moieties, including N-acetylneuraminic acid (a sialic acid) and galactose, linked through specific glycosidic bonds. This structure suggests that it may play a role in biological processes such as cell recognition, signaling, and adhesion, particularly in the context of cellular interactions and immune responses. The presence of acetylamino groups indicates potential solubility in biological fluids and may influence its biological activity. Additionally, the stereochemistry of the sugar units and the specific linkages contribute to its functional properties. Such compounds are often studied for their relevance in glycobiology and potential applications in therapeutics, diagnostics, and vaccine development. Understanding the characteristics of this compound can provide insights into its biological significance and potential uses in medicine and biotechnology.
Formula:C36H59N3O27
InChI:InChI=1S/C36H59N3O27/c1-11(44)37-14(6-40)28(25(54)19(51)10-61-35(33(57)58)4-15(47)21(38-12(2)45)29(64-35)23(52)17(49)7-41)63-32-27(56)31(26(55)20(9-43)62-32)66-36(34(59)60)5-16(48)22(39-13(3)46)30(65-36)24(53)18(50)8-42/h6,14-32,41-43,47-56H,4-5,7-10H2,1-3H3,(H,37,44)(H,38,45)(H,39,46)(H,57,58)(H,59,60)/t14-,15-,16-,17+,18+,19+,20+,21+,22+,23+,24+,25-,26-,27+,28+,29+,30+,31-,32-,35+,36-/m0/s1
InChI key:InChIKey=SKJCZIMWAATHMG-CZYIXMLQSA-N
SMILES:O([C@@]1(C(O)=O)O[C@@]([C@@H]([C@@H](CO)O)O)([C@H](NC(C)=O)[C@@H](O)C1)[H])[C@@H]2[C@@H](O)[C@H](O[C@H]([C@@H](NC(C)=O)C=O)[C@H]([C@@H](CO[C@@]3(C(O)=O)O[C@@]([C@@H]([C@@H](CO)O)O)([C@H](NC(C)=O)[C@@H](O)C3)[H])O)O)O[C@H](CO)[C@@H]2O
Synonyms:- (2S,4S,5R,6R)-5-acetamido-2-[(2R,3R,4S,5S,6R)-2-[(2R,3R,4S,5R)-2-acetamido-6-[(2R,4S,5R,6R)-5-acetamido-2-carboxy-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-2-yl]oxy-4,5-dihydroxy-1-oxo-hexan-3-yl]oxy-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid
- <span class="text-smallcaps">D</smallcap>-Galactose, O-(N-acetyl-α-neuraminosyl)-(2→6)-O-[O-(N-acetyl-α-neuraminosyl)-(2→3)-β-<smallcap>D</span>-galactopyranosyl-(1→3)]-2-(acetylamino)-2-deoxy-
- Disialosyl galactosyl globoside
- O-(N-Acetyl-α-neuraminosyl)-(2→6)-O-[O-(N-acetyl-α-neuraminosyl)-(2→3)-β-<span class="text-smallcaps">D</smallcap>-galactopyranosyl-(1→3)]-2-(acetylamino)-2-deoxy-<smallcap>D</span>-galactose
- O-(N-Acetyl-α-neuraminosyl)-(2→6)-O-[O-(N-acetyl-α-neuraminosyl)-(2→3)-β-D-galactopyranosyl-(1→3)]-2-(acetylamino)-2-deoxy-D-galactose
- D-Galactose, O-(N-acetyl-α-neuraminosyl)-(2→6)-O-[O-(N-acetyl-α-neuraminosyl)-(2→3)-β-D-galactopyranosyl-(1→3)]-2-(acetylamino)-2-deoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Disialyl-TF
CAS:Disialyl-TF is a monoclonal antibody that binds to the CD33 antigen on the surface of all types of cancer cells, including breast cancer cells. Disialyl-TF has been shown to reduce the growth and spread of prostate cancer cells in mice, reducing tumor size and weight. Disialyl-TF is also active against infectious diseases such as HIV, which may be due to its ability to inhibit the expression of glycan receptors. The mechanism by which it works is not yet known. Disialyl-TF has been shown to bind with high affinity to erythrocytes bearing A or B blood group antigens, making it an excellent diagnostic tool for detecting these antigens in patients with acute myeloid leukemia or other cancers.
Formula:C36H59N3O27Purity:Min. 95%Molecular weight:965.86 g/mol
