CymitQuimica logo

CAS 71777-70-3

:

Ethyl 4-ethoxy-2-pyridinecarboxylate

Description:
Ethyl 4-ethoxy-2-pyridinecarboxylate, identified by its CAS number 71777-70-3, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. Typically, it appears as a colorless to pale yellow liquid with a distinctive odor. Ethyl 4-ethoxy-2-pyridinecarboxylate is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as an intermediate in various chemical reactions. The presence of the ethoxy group enhances its solubility in organic solvents, making it useful in various chemical processes. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential therapeutic uses. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C10H13NO3
InChI:InChI=1/C10H13NO3/c1-3-13-8-5-6-11-9(7-8)10(12)14-4-2/h5-7H,3-4H2,1-2H3
InChI key:LJXADWCGSBYCDC-UHFFFAOYSA-N
SMILES:CCOc1ccnc(c1)C(=O)OCC
Synonyms:
  • Ethyl 4-ethoxypicolinate
  • 4-Ethoxy-2-pyridinecarboxylic acid ethyl ester
Found 3 products.