CymitQuimica logo

CAS 718596-77-1

:

Benzenepropanoic acid, b-amino-4-cyano-, (bS)-

Description:
Benzenepropanoic acid, b-amino-4-cyano-, (bS)-, with the CAS number 718596-77-1, is an organic compound characterized by its structural features that include a benzene ring, a propanoic acid moiety, and a cyano group attached to the beta position relative to the amino group. This compound exhibits both acidic and basic properties due to the presence of the carboxylic acid and amino functional groups, allowing it to participate in various chemical reactions, including acid-base reactions and nucleophilic substitutions. The cyano group contributes to its reactivity and can influence the compound's polarity and solubility in different solvents. Additionally, the stereochemistry indicated by (bS)- suggests that the compound has a specific spatial arrangement, which can affect its biological activity and interactions with other molecules. Overall, this compound may have applications in pharmaceuticals or as an intermediate in organic synthesis, owing to its unique functional groups and structural characteristics.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c11-6-7-1-3-8(4-2-7)9(12)5-10(13)14/h1-4,9H,5,12H2,(H,13,14)/t9-/m0/s1
InChI key:JFPLLJRLBHIJPS-VIFPVBQESA-N
SMILES:C1=CC(=CC=C1C#N)[C@H](CC(=O)O)N
Synonyms:
  • (S)-3-Amino-3-(4-cyanophenyl)propionicacid
  • (S)-3-Amino-3-(4-Cyano-Phenyl)-Propionic Acid
Found 4 products.