CAS 7195-78-0
:(3-acetyl-5-chloro-2-hydroxy-phenyl) nitrate
Description:
(3-acetyl-5-chloro-2-hydroxy-phenyl) nitrate, with the CAS number 7195-78-0, is an organic compound characterized by its functional groups and structural features. It contains a phenolic structure, which is a benzene ring substituted with a hydroxyl group, an acetyl group, and a chlorine atom, along with a nitrate group. The presence of the hydroxyl group imparts some degree of polarity, influencing its solubility in polar solvents. The acetyl group contributes to the compound's reactivity, particularly in electrophilic substitution reactions. The chlorine atom introduces additional reactivity and can affect the compound's overall stability and biological activity. This compound may exhibit properties typical of both phenolic compounds and nitrates, including potential applications in pharmaceuticals or as intermediates in organic synthesis. However, specific safety and handling guidelines should be followed due to the potential hazards associated with its chemical structure. As with many organic compounds, its behavior in various environments can be influenced by factors such as pH, temperature, and the presence of other chemical species.
Formula:C8H6ClNO5
InChI:InChI=1/C8H6ClNO5/c1-4(11)6-2-5(9)3-7(8(6)12)15-10(13)14/h2-3,12H,1H3
SMILES:CC(=O)c1cc(cc(c1O)ON(=O)=O)Cl
Synonyms:- 3-Acetyl-5-chloro-2-hydroxyphenyl nitrate
- Ethanone, 1-[5-Chloro-2-Hydroxy-3-(Nitrooxy)Phenyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Chloro-2-hydroxy-3-nitrobenzoic acid
CAS:5-Chloro-2-hydroxy-3-nitrobenzoic acidFormula:C7H4ClNO5Purity:≥95%Color and Shape:SolidMolecular weight:217.563365-Chloro-2-Hydroxy-3-Nitrobenzoic Acid
CAS:Formula:C7H4ClNO5Purity:95%Color and Shape:SolidMolecular weight:217.5634Ref: 10-F671238
100mg78.00€250mg85.00€500mg153.00€1g223.00€2.5g497.00€5g598.00€10g916.00€25g1,505.00€5-chloro-2-hydroxy-3-nitrobenzoic acid
CAS:5-Chloro-2-hydroxy-3-nitrobenzoic acid (5CHNBA) is a potent inhibitor of the HIV integrase. 5CHNBA inhibits the activity of integrase by binding to the enzyme and preventing it from adding new DNA sequences to the viral genome. It has been shown to be effective against HIV integrase in vitro and in vivo, with inhibitory activities against both wild type and drug resistant HIV integrases. 5CHNBA is not an amide or saponified compound, but it does contain a nitrobenzoic group that reacts with chlorine atoms to form chlorination products, such as dichloro 5-chloro-2-hydroxy-3-nitrobenzoic acid.
Formula:C7H4ClNO5Purity:Min. 95%Molecular weight:217.6 g/mol




