
CAS 71968-04-2
:Morphinan-6-one, 4,5-epoxy-3-methoxy-, hydrochloride, (5α)-
Description:
Morphinan-6-one, 4,5-epoxy-3-methoxy-, hydrochloride, commonly referred to by its CAS number 71968-04-2, is a synthetic compound belonging to the morphinan class of alkaloids. This substance is characterized by its complex bicyclic structure, which includes a phenanthrene core and various functional groups that contribute to its pharmacological properties. The presence of the epoxy group and methoxy substituent indicates potential reactivity and biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmaceutical applications. Morphinan derivatives are often studied for their analgesic and psychoactive effects, making them relevant in medicinal chemistry and drug development. The specific stereochemistry, denoted by the (5α) configuration, suggests a particular spatial arrangement of atoms that can influence the compound's interaction with biological targets. Overall, this compound's unique structural features and potential therapeutic applications make it a subject of interest in both research and clinical settings.
Formula:C17H19NO3·ClH
InChI:InChI=1S/C17H19NO3.ClH/c1-20-13-5-2-9-8-11-10-3-4-12(19)16-17(10,6-7-18-11)14(9)15(13)21-16;/h2,5,10-11,16,18H,3-4,6-8H2,1H3;1H/t10-,11+,16-,17-;/m0./s1
InChI key:InChIKey=IQVZQPJFFRBEHK-NRGUFEMZSA-N
SMILES:O=C1[C@]2([C@]34C=5C(O2)=C(OC)C=CC5C[C@]([C@@]3(CC1)[H])(NCC4)[H])[H].Cl
Synonyms:- Morphinan-6-one, 4,5-epoxy-3-methoxy-, hydrochloride, (5α)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Norhydrocodone.HCl, 1mg/ml in Acetonitrile/Water : 1/1 (as free base)
CAS:Controlled ProductColor and Shape:Colourless
