CAS 71989-16-7
:FMOC-L-asparagine
Description:
FMOC-L-asparagine is a derivative of the amino acid asparagine, characterized by the presence of a 9-fluorenylmethoxycarbonyl (FMOC) protective group. This modification enhances its stability and solubility, making it particularly useful in peptide synthesis and other biochemical applications. The FMOC group is known for its ability to be easily removed under mild basic conditions, allowing for selective deprotection during the synthesis of peptides. FMOC-L-asparagine retains the essential properties of asparagine, including its polar side chain, which can participate in hydrogen bonding and contribute to protein structure and function. This compound is typically utilized in research and industrial settings, particularly in the synthesis of peptides where the protection of the amino group is necessary to prevent unwanted reactions. Additionally, FMOC-L-asparagine is soluble in organic solvents and water, facilitating its use in various chemical reactions and formulations. Overall, FMOC-L-asparagine serves as a valuable building block in the field of organic and medicinal chemistry.
Formula:C19H18N2O5
InChI:InChI=1S/C19H18N2O5/c20-17(22)9-16(18(23)24)21-19(25)26-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2,(H2,20,22)(H,21,25)(H,23,24)/t16-/m0/s1
InChI key:InChIKey=YUGBZNJSGOBFOV-INIZCTEOSA-N
SMILES:C(OC(N[C@@H](CC(N)=O)C(O)=O)=O)C1C=2C(C=3C1=CC=CC3)=CC=CC2
Synonyms:- (2S)-3-Carbamoyl-2-([[(9H-fluoren-9-yl)methoxy]carbonyl]amino)propanoic acid
- (2S)-4-Amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid
- (2S)-4-amino-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-oxobutanoate
- <span class="text-smallcaps">L</span>-Asparagine, N<sup>2</sup>-[(9H-fluoren-9-ylmethoxy)carbonyl]-
- FMOC-<span class="text-smallcaps">L</span>-asparagine
- Fmoc-Asn-OH
- Fmoc-L-asparagine
- N-(9-Fluorenylmethoxycarbonyl)asparagine
- N-FMOC-<span class="text-smallcaps">L</span>-asparagine
- N2-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-asparagine
- N<sup>2</sup>-(9-Fluorenylmethoxycarbonyl)asparagine
- N<sup>2</sup>-[(9H-Fluoren-9-ylmethoxy)carbonyl]-<span class="text-smallcaps">L</span>-asparagine
- NSC 334297
- Nalpha-Fmoc-L-Asparagine
- N~2~-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-asparagine
- N~2~-[(9H-fluoren-9-ylmethoxy)carbonyl]asparagine
- N2-(9-Fluorenylmethoxycarbonyl)asparagine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Fmoc-Asn-OH
CAS:(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-amino-4-oxobutanoic acidFormula:C19H18N2O5Purity:98%Molecular weight:354.36Nα-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-asparagine
CAS:Formula:C19H18N2O5Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:354.36Fmoc-L-Asn-OH
CAS:Fmoc-L-Asn-OH is an organic compound that belongs to the group of amides. It reacts with a reactive site in the molecule and is able to form an amide bond. Fmoc-L-Asn-OH has been shown to be effective in the treatment of Alzheimer's disease by inhibiting the formation of beta-amyloid plaques. This compound has also been shown to have a role in cancer prevention, as it can inhibit tumor growth and reduce tumor size. Fmoc-L-Asn-OH can be used as a potential antiinflammatory agent because its mechanism studies have revealed that it inhibits prostaglandin synthesis.Formula:C19H18N2O5Purity:Min. 95%Color and Shape:PowderMolecular weight:354.36 g/molFmoc-Asn-OH
CAS:M03351 - Fmoc-Asn-OH
Formula:C19H18N2O5Purity:97%Color and Shape:SolidMolecular weight:354.362FMOC-L-Asparagine extrapure, 99%
CAS:Formula:C19H18N2O5Purity:min. 99%Color and Shape:White to Slight yellow, Crystalline powderMolecular weight:354.40
![Nα-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-asparagine](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2F3B%2Fthumb%2FF0306.jpg&w=3840&q=75)
