CymitQuimica logo

CAS 7206-61-3

:

1-Azulenecarboxaldehyde

Description:
1-Azulenecarboxaldehyde, with the CAS number 7206-61-3, is an organic compound characterized by its unique azulene structure, which is a bicyclic compound known for its deep blue color and aromatic properties. This compound features a carboxaldehyde functional group (-CHO) attached to the azulene framework, contributing to its reactivity and potential applications in organic synthesis. 1-Azulenecarboxaldehyde is typically a liquid at room temperature and exhibits a distinctive odor. Its chemical properties include the ability to undergo typical aldehyde reactions, such as oxidation and condensation. The presence of the azulene moiety imparts interesting electronic properties, making it a subject of interest in materials science and organic electronics. Additionally, due to its aromatic nature, it may exhibit fluorescence and other photophysical properties. Overall, 1-Azulenecarboxaldehyde serves as a valuable compound in various chemical research fields, including synthetic organic chemistry and the development of novel materials.
Formula:C11H8O
InChI:InChI=1S/C11H8O/c12-8-10-7-6-9-4-2-1-3-5-11(9)10/h1-8H
InChI key:CZRXLQPVJOJLML-UHFFFAOYSA-N
SMILES:C1=CC=C2C=CC(=C2C=C1)C=O
Found 4 products.