CAS 72214-67-6

2,4-dichlorobenzyl carbamimidothioate

Description:

2,4-Dichlorobenzyl carbamimidothioate is a chemical compound characterized by its unique structure, which includes a benzyl group substituted with two chlorine atoms at the 2 and 4 positions, along with a carbamimidothioate functional group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including agriculture and pharmaceuticals. The presence of the dichlorobenzyl moiety may impart specific biological activity, making it of interest in the development of pesticides or herbicides. Additionally, the carbamimidothioate group can exhibit properties related to thiol chemistry, which may influence its reactivity and interactions with biological systems. Safety and handling precautions are essential when working with this compound, as it may pose health risks if not managed properly. Overall, 2,4-dichlorobenzyl carbamimidothioate represents a compound with significant chemical interest due to its structural features and potential applications.

Formula: C₈H₈Cl₂N₂S

InChI: InChI=1/C8H8Cl2N2S/c9-6-2-1-5(7(10)3-6)4-13-8(11)12/h1-3H,4H2,(H3,11,12)

SMILES: c1cc(cc(c1CSC(=N)N)Cl)Cl

Synonyms:

• Carbamimidothioic Acid, (2,4-Dichlorophenyl)Methyl Ester
• 2,4-Dichlorobenzyl carbamimidothioate

RRD-251

CAS: 72214-67-6

2,4-Dichlorobenzyl carbamimidothioate hydrochloride

Formula: C₈H₉Cl₃N₂S

Purity: 99%

Molecular weight: 271.59

Ref: IN-DG00826610

2-(2,4-Dichlorobenzyl)thiourea hydrochloride

CAS: 72214-67-6

2-(2,4-Dichlorobenzyl)thiourea hydrochloride

Formula: C₈H₈Cl₂N₂S·ClH

Purity: ≥95%

Molecular weight: 271.59446

Ref: 54-OR54753

RRD-251

CAS: 72214-67-6

RRD-251 is an Rb-Raf-1 interaction inhibitor that induces tumor cell apoptosis by disrupting the receptor complex.

Formula: C₈H₉Cl₃N₂S

Purity: 99.95%

Color and Shape: White Solid

Molecular weight: 271.59

Ref: TM-T60475