CAS 723-89-7
:1-Phenylisatin
Description:
1-Phenylisatin, with the CAS number 723-89-7, is an organic compound that belongs to the class of isatins, which are derived from indole and characterized by the presence of a carbonyl group adjacent to a nitrogen atom in a cyclic structure. This compound typically appears as a yellow to orange crystalline solid and is known for its diverse biological activities, including potential antimicrobial and anticancer properties. Its molecular structure features a phenyl group attached to the nitrogen of the isatin moiety, which can influence its reactivity and interaction with biological targets. 1-Phenylisatin is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but its solubility in water is limited. The compound can undergo various chemical reactions, including oxidation and substitution, making it a valuable intermediate in organic synthesis. Due to its unique properties, 1-Phenylisatin is of interest in medicinal chemistry and material science, where it may serve as a scaffold for the development of new therapeutic agents.
Formula:C14H9NO2
InChI:InChI=1S/C14H9NO2/c16-13-11-8-4-5-9-12(11)15(14(13)17)10-6-2-1-3-7-10/h1-9H
InChI key:InChIKey=UWCPWBIMRYXUOU-UHFFFAOYSA-N
SMILES:O=C1N(C=2C(C1=O)=CC=CC2)C3=CC=CC=C3
Synonyms:- 1-Phenyl-1H-indole-2,3-dione
- 1-Phenyl-2,3-dihydro-1H-indole-2,3-dione
- 1-Phenyl-2,3-indolinedione
- 1-Phenyl-indole-2,3-dione
- 1-Phenylindole-2,3-dione
- 1H-Indole-2,3-dione, 1-phenyl-
- 1H-Indole-2,3-dione, 1-phenyl- (9CI)
- Brn 0164531
- Indole-2,3-dione, 1-phenyl-
- Isatin, 1-phenyl-
- N-Phenylisatin
- Nsc 100013
- 1-Phenylisatin
- 1-Phenylisatin
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-Phenylisatin, 98%
CAS:1-Phenylisatin is a reactant for preparation of indolin-2,3-dione Schiff bases as potential antimycobacterial agents, antipyretic agents, antiproliferative agents, phenylacetamides as anticonvulsant agents and selective Galanin GAL3 receptor antagonists. This Thermo Scientific Chemicals brand producFormula:C14H9NO2Purity:98%Color and Shape:Crystals or powder or crystalline powder or fused solid, Dark orange to orange to redMolecular weight:223.231-Phenylindoline-2,3-dione
CAS:Formula:C14H9NO2Purity:98%Color and Shape:SolidMolecular weight:223.22681-Phenyl-2,3-dihydro-1H-indole-2,3-dione
CAS:1-Phenyl-2,3-dihydro-1H-indole-2,3-dioneFormula:C14H9NO2Purity:>98%Molecular weight:223.226761-Phenylisatin
CAS:Formula:C14H9NO2Purity:>98.0%(GC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:223.23





