CymitQuimica logo

CAS 72411-89-3

:

4-Methoxy-5-pyrimidinecarboxylic acid

Description:
4-Methoxy-5-pyrimidinecarboxylic acid is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. This compound features a methoxy group (-OCH3) at the 4-position and a carboxylic acid group (-COOH) at the 5-position of the pyrimidine ring. It is typically a white to off-white crystalline solid, soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid functional group. The methoxy group contributes to its overall polarity and can influence its reactivity and interaction with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and the presence of other chemical species. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C6H6N2O3
InChI:InChI=1S/C6H6N2O3/c1-11-5-4(6(9)10)2-7-3-8-5/h2-3H,1H3,(H,9,10)
InChI key:InChIKey=WMSJDLVVPJFZBF-UHFFFAOYSA-N
SMILES:O(C)C=1C(C(O)=O)=CN=CN1
Synonyms:
  • 5-Pyrimidinecarboxylic acid, 4-Methoxy-
  • 4-Methoxy-5-pyrimidinecarboxylic acid
Found 4 products.